mirror of
https://git.ryujinx.app/kenji-nx/ryujinx.git
synced 2025-12-12 01:37:02 +00:00
Rename "RyuFs" directory to "Ryujinx" and use the same savedata system the Switch uses (#801)
* Use savedata FS commands from LibHac * Add EnsureSaveData. Use ApplicationControlProperty struct * Add a function to migrate to the new directory layout * LibHac update * Change backup structure * Don't create UI files in the save path * Update RyuFs paths * Add GetProgramIndexForAccessLog Ryujinx only runs one program at a time, so always return values reflecting that * Load control NCA when loading from an NSP * Skip over UI stats when exiting * Set TitleName and TitleId in more cases. Fix TitleID naming style * Completely comment out GUI play stats code * rebase * Update LibHac * Update LibHac * Revert UI changes * Do migration automatically at startup * Rename RyuFs directory to Ryujinx * Update RyuFs text * Store savedata paths in the GUI * Make "Open Save Directory" work * Use a dummy NACP in EnsureSaveData if one is not loaded * Remove manual migration button * Respond to feedback * Don't read the installer config to get a version string * Delete nuget.config * Exclude 'sdcard' and 'bis' during migration Co-authored-by: Thog <thog@protonmail.com>
This commit is contained in:
parent
e0e12b1672
commit
63b24b4af2
22 changed files with 877 additions and 384 deletions
|
|
@ -1,22 +1,21 @@
|
|||
using Gtk;
|
||||
using JsonPrettyPrinterPlus;
|
||||
using Ryujinx.Audio;
|
||||
using Ryujinx.Common.Logging;
|
||||
using Ryujinx.Configuration;
|
||||
using Ryujinx.Graphics.Gal;
|
||||
using Ryujinx.Graphics.Gal.OpenGL;
|
||||
using Ryujinx.HLE.FileSystem;
|
||||
using Ryujinx.Profiler;
|
||||
using System;
|
||||
using System.Diagnostics;
|
||||
using System.IO;
|
||||
using System.Reflection;
|
||||
using System.Text;
|
||||
using System.Threading;
|
||||
using Ryujinx.Configuration;
|
||||
using System.Diagnostics;
|
||||
using System.Threading.Tasks;
|
||||
using Utf8Json;
|
||||
using JsonPrettyPrinterPlus;
|
||||
using Utf8Json.Resolvers;
|
||||
using Ryujinx.HLE.FileSystem;
|
||||
|
||||
|
||||
using GUI = Gtk.Builder.ObjectAttribute;
|
||||
|
||||
|
|
@ -74,6 +73,12 @@ namespace Ryujinx.Ui
|
|||
|
||||
_gameTable.ButtonReleaseEvent += Row_Clicked;
|
||||
|
||||
bool continueWithStartup = Migration.PromptIfMigrationNeededForStartup(this, out bool migrationNeeded);
|
||||
if (!continueWithStartup)
|
||||
{
|
||||
End();
|
||||
}
|
||||
|
||||
_renderer = new OglRenderer();
|
||||
|
||||
_audioOut = InitializeAudioEngine();
|
||||
|
|
@ -81,6 +86,16 @@ namespace Ryujinx.Ui
|
|||
// TODO: Initialization and dispose of HLE.Switch when starting/stoping emulation.
|
||||
_device = InitializeSwitchInstance();
|
||||
|
||||
if (migrationNeeded)
|
||||
{
|
||||
bool migrationSuccessful = Migration.DoMigrationForStartup(this, _device);
|
||||
|
||||
if (!migrationSuccessful)
|
||||
{
|
||||
End();
|
||||
}
|
||||
}
|
||||
|
||||
_treeView = _gameTable;
|
||||
|
||||
ApplyTheme();
|
||||
|
|
@ -198,7 +213,9 @@ namespace Ryujinx.Ui
|
|||
|
||||
_tableStore.Clear();
|
||||
|
||||
await Task.Run(() => ApplicationLibrary.LoadApplications(ConfigurationState.Instance.Ui.GameDirs, _device.System.KeySet, _device.System.State.DesiredTitleLanguage));
|
||||
await Task.Run(() => ApplicationLibrary.LoadApplications(ConfigurationState.Instance.Ui.GameDirs,
|
||||
_device.System.KeySet, _device.System.State.DesiredTitleLanguage, _device.System.FsClient,
|
||||
_device.FileSystem));
|
||||
|
||||
_updatingGameTable = false;
|
||||
}
|
||||
|
|
@ -377,8 +394,8 @@ namespace Ryujinx.Ui
|
|||
}
|
||||
|
||||
Profile.FinishProfiling();
|
||||
_device.Dispose();
|
||||
_audioOut.Dispose();
|
||||
_device?.Dispose();
|
||||
_audioOut?.Dispose();
|
||||
Logger.Shutdown();
|
||||
Environment.Exit(0);
|
||||
}
|
||||
|
|
@ -474,7 +491,7 @@ namespace Ryujinx.Ui
|
|||
|
||||
if (treeIter.UserData == IntPtr.Zero) return;
|
||||
|
||||
GameTableContextMenu contextMenu = new GameTableContextMenu(_tableStore, treeIter);
|
||||
GameTableContextMenu contextMenu = new GameTableContextMenu(_tableStore, treeIter, _device.System.FsClient);
|
||||
contextMenu.ShowAll();
|
||||
contextMenu.PopupAtPointer(null);
|
||||
}
|
||||
|
|
|
|||
Loading…
Add table
Add a link
Reference in a new issue